C23H19ClN4O3S — CID 135786970
2-[(2E)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide (PubChem CID 135786970) has the molecular formula C23H19ClN4O3S and a molecular weight of 466.95 g/mol. Its IUPAC name is 2-[(2E)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2E)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 135786970 |
| Molecular Formula | C23H19ClN4O3S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 2-[(2E)-2-[[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2S/C(=N/N=Cc3ccc(-c4cccc(Cl)c4)o3)NC2=O)cc1 |
| InChI | InChI=1S/C23H19ClN4O3S/c1-14-5-7-17(8-6-14)26-21(29)12-20-22(30)27-23(32-20)28-25-13-18-9-10-19(31-18)15-3-2-4-16(24)11-15/h2-11,13,20H,12H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | WZKLVTDSGDKZCW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|