C23H16ClF3N4O3S — CID 135575297
N-(4-chlorophenyl)-2-[(2Z)-4-oxo-2-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135575297) has the molecular formula C23H16ClF3N4O3S and a molecular weight of 520.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2Z)-4-oxo-2-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2Z)-4-oxo-2-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135575297 |
| Molecular Formula | C23H16ClF3N4O3S |
| Molecular Weight | 520.92 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2Z)-4-oxo-2-[(E)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N\N=C\c2ccc(-c3cccc(C(F)(F)F)c3)o2)NC1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClF3N4O3S/c24-15-4-6-16(7-5-15)29-20(32)11-19-21(33)30-22(35-19)31-28-12-17-8-9-18(34-17)13-2-1-3-14(10-13)23(25,26)27/h1-10,12,19H,11H2,(H,29,32)(H,30,31,33)/b28-12+ |
| InChIKey | VGFLIQSECKIIBG-KVSWJAHQSA-N |
| XLogP | 5.57 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.92 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|