C22H16Cl2N4O3S — CID 135786933
2-[(2Z)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135786933) has the molecular formula C22H16Cl2N4O3S and a molecular weight of 487.37 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135786933 |
| Molecular Formula | C22H16Cl2N4O3S |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 2-[(2Z)-2-[[5-(2,3-dichlorophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N\N=Cc2ccc(-c3cccc(Cl)c3Cl)o2)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H16Cl2N4O3S/c23-16-8-4-7-15(20(16)24)17-10-9-14(31-17)12-25-28-22-27-21(30)18(32-22)11-19(29)26-13-5-2-1-3-6-13/h1-10,12,18H,11H2,(H,26,29)(H,27,28,30) |
| InChIKey | UNRXBJJQZQIXBZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|