C23H19N5O6S — CID 135575280
N-(4-methoxyphenyl)-2-[(2Z)-2-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135575280) has the molecular formula C23H19N5O6S and a molecular weight of 493.50 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(2Z)-2-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(2Z)-2-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135575280 |
| Molecular Formula | C23H19N5O6S |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(2Z)-2-[(E)-[5-(2-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CC2S/C(=N\N=C\c3ccc(-c4ccccc4[N+](=O)[O-])o3)NC2=O)cc1 |
| InChI | InChI=1S/C23H19N5O6S/c1-33-15-8-6-14(7-9-15)25-21(29)12-20-22(30)26-23(35-20)27-24-13-16-10-11-19(34-16)17-4-2-3-5-18(17)28(31)32/h2-11,13,20H,12H2,1H3,(H,25,29)(H,26,27,30)/b24-13+ |
| InChIKey | JYYBRRXDLBFMKZ-ZMOGYAJESA-N |
| XLogP | 3.81 |
| TPSA | 148.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|