C22H16ClN5O5S — CID 135786844
2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135786844) has the molecular formula C22H16ClN5O5S and a molecular weight of 497.92 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135786844 |
| Molecular Formula | C22H16ClN5O5S |
| Molecular Weight | 497.92 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1S/C(=N\N=Cc2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H16ClN5O5S/c23-16-8-6-13(10-17(16)28(31)32)18-9-7-15(33-18)12-24-27-22-26-21(30)19(34-22)11-20(29)25-14-4-2-1-3-5-14/h1-10,12,19H,11H2,(H,25,29)(H,26,27,30) |
| InChIKey | AFZIGDHSLIEGPR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.92 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|