C16H12N4O6S — CID 135599638
2-[(2Z)-2-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135599638) has the molecular formula C16H12N4O6S and a molecular weight of 388.36 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135599638 |
| Molecular Formula | C16H12N4O6S |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-[(2Z)-2-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1S/C(=N\N=C\c2ccc(-c3cccc([N+](=O)[O-])c3)o2)NC1=O |
| InChI | InChI=1S/C16H12N4O6S/c21-14(22)7-13-15(23)18-16(27-13)19-17-8-11-4-5-12(26-11)9-2-1-3-10(6-9)20(24)25/h1-6,8,13H,7H2,(H,21,22)(H,18,19,23)/b17-8+ |
| InChIKey | FPVSTMRVJMXSIN-CAOOACKPSA-N |
| XLogP | 2.25 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|