C10H8N4O6S — CID 135545521
2-[2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135545521) has the molecular formula C10H8N4O6S and a molecular weight of 312.26 g/mol. Its IUPAC name is 2-[2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135545521 |
| Molecular Formula | C10H8N4O6S |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-[2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)CC1SC(=NN=Cc2ccc([N+](=O)[O-])o2)NC1=O |
| InChI | InChI=1S/C10H8N4O6S/c15-8(16)3-6-9(17)12-10(21-6)13-11-4-5-1-2-7(20-5)14(18)19/h1-2,4,6H,3H2,(H,15,16)(H,12,13,17) |
| InChIKey | AOCLKLOOJJFEKK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|