C18H17N5O5S — CID 136666637
N-(2,4-dimethylphenyl)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 136666637) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 136666637 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CC2S/C(=N\N=Cc3ccc([N+](=O)[O-])o3)NC2=O)c(C)c1 |
| InChI | InChI=1S/C18H17N5O5S/c1-10-3-5-13(11(2)7-10)20-15(24)8-14-17(25)21-18(29-14)22-19-9-12-4-6-16(28-12)23(26)27/h3-7,9,14H,8H2,1-2H3,(H,20,24)(H,21,22,25) |
| InChIKey | MXVDELRBRNOTIP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|