C12H13N5O5S — CID 135909761
N-ethyl-2-[(2E,5R)-2-[(Z)-(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135909761) has the molecular formula C12H13N5O5S and a molecular weight of 339.33 g/mol. Its IUPAC name is N-ethyl-2-[(2E,5R)-2-[(Z)-(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-ethyl-2-[(2E,5R)-2-[(Z)-(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135909761 |
| Molecular Formula | C12H13N5O5S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-ethyl-2-[(2E,5R)-2-[(Z)-(5-nitrofuran-2-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCNC(=O)C[C@H]1S/C(=N/N=C\c2ccc([N+](=O)[O-])o2)NC1=O |
| InChI | InChI=1S/C12H13N5O5S/c1-2-13-9(18)5-8-11(19)15-12(23-8)16-14-6-7-3-4-10(22-7)17(20)21/h3-4,6,8H,2,5H2,1H3,(H,13,18)(H,15,16,19)/b14-6-/t8-/m1/s1 |
| InChIKey | IZSXPIKHIFJTON-AXFUIOLUSA-N |
| XLogP | 0.64 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|