C18H15ClN4O2S — CID 135525821
2-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135525821) has the molecular formula C18H15ClN4O2S and a molecular weight of 386.86 g/mol. Its IUPAC name is 2-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135525821 |
| Molecular Formula | C18H15ClN4O2S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-[2-[(2-chlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1SC(=NN=Cc2ccccc2Cl)NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H15ClN4O2S/c19-14-9-5-4-6-12(14)11-20-23-18-22-17(25)15(26-18)10-16(24)21-13-7-2-1-3-8-13/h1-9,11,15H,10H2,(H,21,24)(H,22,23,25) |
| InChIKey | PXKAOPPQNJOBOG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|