C19H15N4O4S- — CID 135852079
2-[(Z)-[(E)-[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoate (PubChem CID 135852079) has the molecular formula C19H15N4O4S- and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[(Z)-[(E)-[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoate.
| Compound Name | 2-[(Z)-[(E)-[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 135852079 |
| Molecular Formula | C19H15N4O4S- |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-[(Z)-[(E)-[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]benzoate |
| SMILES | O=C(C[C@@H]1S/C(=N/N=C\c2ccccc2C(=O)[O-])NC1=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H16N4O4S/c24-16(21-13-7-2-1-3-8-13)10-15-17(25)22-19(28-15)23-20-11-12-6-4-5-9-14(12)18(26)27/h1-9,11,15H,10H2,(H,21,24)(H,26,27)(H,22,23,25)/p-1/b20-11-/t15-/m0/s1 |
| InChIKey | WJMHBJYIFMSCCE-PFHZTYADSA-M |
| XLogP | 1.00 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|