C24H19FN4O5S2 — CID 135845569
[2-[[(Z)-[5-[2-(4-fluoroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 135845569) has the molecular formula C24H19FN4O5S2 and a molecular weight of 526.57 g/mol. Its IUPAC name is [2-[[(Z)-[5-[2-(4-fluoroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2-[[(Z)-[5-[2-(4-fluoroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 135845569 |
| Molecular Formula | C24H19FN4O5S2 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.08 |
| IUPAC Name | [2-[[(Z)-[5-[2-(4-fluoroanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C(CC1S/C(=N\N=Cc2ccccc2OS(=O)(=O)c2ccccc2)NC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN4O5S2/c25-17-10-12-18(13-11-17)27-22(30)14-21-23(31)28-24(35-21)29-26-15-16-6-4-5-9-20(16)34-36(32,33)19-7-2-1-3-8-19/h1-13,15,21H,14H2,(H,27,30)(H,28,29,31) |
| InChIKey | CWGULMWTSFHARY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|