C22H14Cl2F3N3O2S — CID 135769247
(2Z,5R)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135769247) has the molecular formula C22H14Cl2F3N3O2S and a molecular weight of 512.34 g/mol. Its IUPAC name is (2Z,5R)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135769247 |
| Molecular Formula | C22H14Cl2F3N3O2S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | (2Z,5R)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C\c2ccc(-c3cccc(C(F)(F)F)c3)o2)S[C@@H]1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H14Cl2F3N3O2S/c23-15-4-6-17(24)13(9-15)10-19-20(31)29-21(33-19)30-28-11-16-5-7-18(32-16)12-2-1-3-14(8-12)22(25,26)27/h1-9,11,19H,10H2,(H,29,30,31)/b28-11-/t19-/m1/s1 |
| InChIKey | QRRWGRPMSKYHMA-YUPMQLCYSA-N |
| XLogP | 6.44 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|