C21H14Cl3N3O2S — CID 135711989
(2E)-2-[(E)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135711989) has the molecular formula C21H14Cl3N3O2S and a molecular weight of 478.79 g/mol. Its IUPAC name is (2E)-2-[(E)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135711989 |
| Molecular Formula | C21H14Cl3N3O2S |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | (2E)-2-[(E)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2ccc(-c3ccccc3Cl)o2)SC1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H14Cl3N3O2S/c22-13-5-7-16(23)12(9-13)10-19-20(28)26-21(30-19)27-25-11-14-6-8-18(29-14)15-3-1-2-4-17(15)24/h1-9,11,19H,10H2,(H,26,27,28)/b25-11+ |
| InChIKey | UJZCGTMGBUOTRB-OPEKNORGSA-N |
| XLogP | 6.07 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|