C21H15ClFN3O2S — CID 135878944
(2Z,5S)-2-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135878944) has the molecular formula C21H15ClFN3O2S and a molecular weight of 427.89 g/mol. Its IUPAC name is (2Z,5S)-2-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-2-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135878944 |
| Molecular Formula | C21H15ClFN3O2S |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | (2Z,5S)-2-[(Z)-[5-(2-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(4-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C\c2ccc(-c3ccccc3Cl)o2)S[C@H]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H15ClFN3O2S/c22-17-4-2-1-3-16(17)18-10-9-15(28-18)12-24-26-21-25-20(27)19(29-21)11-13-5-7-14(23)8-6-13/h1-10,12,19H,11H2,(H,25,26,27)/b24-12-/t19-/m0/s1 |
| InChIKey | FGQHVSFPXJJRPM-BTMMFNIDSA-N |
| XLogP | 4.90 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|