C24H19ClF3N3O3S — CID 135712201
(2E)-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-5-[(4-ethoxyphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135712201) has the molecular formula C24H19ClF3N3O3S and a molecular weight of 521.95 g/mol. Its IUPAC name is (2E)-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-5-[(4-ethoxyphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-5-[(4-ethoxyphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712201 |
| Molecular Formula | C24H19ClF3N3O3S |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | (2E)-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-5-[(4-ethoxyphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(CC2S/C(=N/N=C/c3ccc(-c4cc(C(F)(F)F)ccc4Cl)o3)NC2=O)cc1 |
| InChI | InChI=1S/C24H19ClF3N3O3S/c1-2-33-16-6-3-14(4-7-16)11-21-22(32)30-23(35-21)31-29-13-17-8-10-20(34-17)18-12-15(24(26,27)28)5-9-19(18)25/h3-10,12-13,21H,2,11H2,1H3,(H,30,31,32)/b29-13+ |
| InChIKey | RLFVXCNCGRQJFM-VFLNYLIXSA-N |
| XLogP | 6.18 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|