C22H14Cl2F3N3O2S — CID 135712029
(2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135712029) has the molecular formula C22H14Cl2F3N3O2S and a molecular weight of 512.34 g/mol. Its IUPAC name is (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712029 |
| Molecular Formula | C22H14Cl2F3N3O2S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 511.01 |
| IUPAC Name | (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[5-[2-chloro-5-(trifluoromethyl)phenyl]furan-2-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2ccc(-c3cc(C(F)(F)F)ccc3Cl)o2)SC1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl2F3N3O2S/c23-14-4-1-12(2-5-14)9-19-20(31)29-21(33-19)30-28-11-15-6-8-18(32-15)16-10-13(22(25,26)27)3-7-17(16)24/h1-8,10-11,19H,9H2,(H,29,30,31)/b28-11+ |
| InChIKey | BIHNXKSKKMUBEK-IPBVOBEMSA-N |
| XLogP | 6.44 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|