C21H15Cl2N3O2S — CID 135920456
(2Z,5R)-2-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135920456) has the molecular formula C21H15Cl2N3O2S and a molecular weight of 444.34 g/mol. Its IUPAC name is (2Z,5R)-2-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135920456 |
| Molecular Formula | C21H15Cl2N3O2S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | (2Z,5R)-2-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C\c2ccc(-c3cccc(Cl)c3)o2)S[C@@H]1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H15Cl2N3O2S/c22-15-5-1-3-13(9-15)10-19-20(27)25-21(29-19)26-24-12-17-7-8-18(28-17)14-4-2-6-16(23)11-14/h1-9,11-12,19H,10H2,(H,25,26,27)/b24-12-/t19-/m1/s1 |
| InChIKey | GERDBPIXVJGFRW-HRGKPLJHSA-N |
| XLogP | 5.42 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|