C22H22F2N4O2S2 — CID 136906275
(2E,5R)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136906275) has the molecular formula C22H22F2N4O2S2 and a molecular weight of 476.57 g/mol. Its IUPAC name is (2E,5R)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5R)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136906275 |
| Molecular Formula | C22H22F2N4O2S2 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | (2E,5R)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(4-morpholin-4-ylphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C/c2ccc(N3CCOCC3)cc2)S[C@@H]1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C22H22F2N4O2S2/c23-21(24)31-18-7-3-15(4-8-18)13-19-20(29)26-22(32-19)27-25-14-16-1-5-17(6-2-16)28-9-11-30-12-10-28/h1-8,14,19,21H,9-13H2,(H,26,27,29)/b25-14-/t19-/m1/s1 |
| InChIKey | MFFPBKZVRROHNR-LPANUZLBSA-N |
| XLogP | 4.00 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|