C26H22F2N4OS2 — CID 135776388
(2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(9-ethylcarbazol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135776388) has the molecular formula C26H22F2N4OS2 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(9-ethylcarbazol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(9-ethylcarbazol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135776388 |
| Molecular Formula | C26H22F2N4OS2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(9-ethylcarbazol-3-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCn1c2ccccc2c2cc(C=N/N=C3\NC(=O)C(Cc4ccc(SC(F)F)cc4)S3)ccc21 |
| InChI | InChI=1S/C26H22F2N4OS2/c1-2-32-21-6-4-3-5-19(21)20-13-17(9-12-22(20)32)15-29-31-26-30-24(33)23(35-26)14-16-7-10-18(11-8-16)34-25(27)28/h3-13,15,23,25H,2,14H2,1H3,(H,30,31,33) |
| InChIKey | POQJELPQRJSDGS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|