C17H14F2N4OS2 — CID 137187527
5-[[3-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-pyridin-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 137187527) has the molecular formula C17H14F2N4OS2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-[[3-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-pyridin-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[[3-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-pyridin-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137187527 |
| Molecular Formula | C17H14F2N4OS2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-[[3-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-pyridin-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=N/N=C/c2ccccn2)SC1Cc1cccc(SC(F)F)c1 |
| InChI | InChI=1S/C17H14F2N4OS2/c18-16(19)25-13-6-3-4-11(8-13)9-14-15(24)22-17(26-14)23-21-10-12-5-1-2-7-20-12/h1-8,10,14,16H,9H2,(H,22,23,24)/b21-10+ |
| InChIKey | CIZCEUDVSNCUDP-UFFVCSGVSA-N |
| XLogP | 3.56 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|