C19H15F4N3O2S2 — CID 135666059
(2E)-2-[[2-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 135666059) has the molecular formula C19H15F4N3O2S2 and a molecular weight of 457.47 g/mol. Its IUPAC name is (2E)-2-[[2-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[[2-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135666059 |
| Molecular Formula | C19H15F4N3O2S2 |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | (2E)-2-[[2-(difluoromethoxy)phenyl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=Cc2ccccc2OC(F)F)SC1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H15F4N3O2S2/c20-17(21)28-14-4-2-1-3-12(14)10-24-26-19-25-16(27)15(30-19)9-11-5-7-13(8-6-11)29-18(22)23/h1-8,10,15,17-18H,9H2,(H,25,26,27) |
| InChIKey | HCFKCVPPKKUMMP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|