C24H21F3N4OS2 — CID 135675908
(2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135675908) has the molecular formula C24H21F3N4OS2 and a molecular weight of 502.59 g/mol. Its IUPAC name is (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135675908 |
| Molecular Formula | C24H21F3N4OS2 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(/C=N/N=C2\NC(=O)C(Cc3ccc(SC(F)F)cc3)S2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C24H21F3N4OS2/c1-14-11-17(15(2)31(14)20-6-4-3-5-19(20)25)13-28-30-24-29-22(32)21(34-24)12-16-7-9-18(10-8-16)33-23(26)27/h3-11,13,21,23H,12H2,1-2H3,(H,29,30,32)/b28-13+ |
| InChIKey | HEWZFYKWVFREAA-XODNFHPESA-N |
| XLogP | 5.71 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|