C22H17F2N3O2S2 — CID 135628295
(2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135628295) has the molecular formula C22H17F2N3O2S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135628295 |
| Molecular Formula | C22H17F2N3O2S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(E)-(2-hydroxynaphthalen-1-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2c(O)ccc3ccccc23)SC1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C22H17F2N3O2S2/c23-21(24)30-15-8-5-13(6-9-15)11-19-20(29)26-22(31-19)27-25-12-17-16-4-2-1-3-14(16)7-10-18(17)28/h1-10,12,19,21,28H,11H2,(H,26,27,29)/b25-12+ |
| InChIKey | ZMEMPRRFEYAFJN-BRJLIKDPSA-N |
| XLogP | 5.02 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|