C27H21F2N5OS2 — CID 136829496
(2Z,5S)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136829496) has the molecular formula C27H21F2N5OS2 and a molecular weight of 533.63 g/mol. Its IUPAC name is (2Z,5S)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136829496 |
| Molecular Formula | C27H21F2N5OS2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | (2Z,5S)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-[(Z)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C\c2cn(-c3ccccc3)nc2-c2ccccc2)S[C@H]1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C27H21F2N5OS2/c28-26(29)36-22-13-11-18(12-14-22)15-23-25(35)31-27(37-23)32-30-16-20-17-34(21-9-5-2-6-10-21)33-24(20)19-7-3-1-4-8-19/h1-14,16-17,23,26H,15H2,(H,31,32,35)/b30-16-/t23-/m0/s1 |
| InChIKey | BURYFFRDICPOEP-NORXXVMPSA-N |
| XLogP | 6.02 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|