C29H27N5OS — CID 135712280
(2E)-2-[(E)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135712280) has the molecular formula C29H27N5OS and a molecular weight of 493.64 g/mol. Its IUPAC name is (2E)-2-[(E)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712280 |
| Molecular Formula | C29H27N5OS |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (2E)-2-[(E)-(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1ccc(CC2S/C(=N/N=C/c3cn(-c4ccccc4)nc3-c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C29H27N5OS/c1-20(2)22-15-13-21(14-16-22)17-26-28(35)31-29(36-26)32-30-18-24-19-34(25-11-7-4-8-12-25)33-27(24)23-9-5-3-6-10-23/h3-16,18-20,26H,17H2,1-2H3,(H,31,32,35)/b30-18+ |
| InChIKey | LJUGTHIOBRBDBM-UXHLAJHPSA-N |
| XLogP | 5.83 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|