C20H20N4O3S — CID 136690155
(2Z,5R)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 136690155) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is (2Z,5R)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136690155 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | (2Z,5R)-2-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)c1ccc(C[C@H]2S/C(=N\N=C/c3ccc([N+](=O)[O-])cc3)NC2=O)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-13(2)16-7-3-14(4-8-16)11-18-19(25)22-20(28-18)23-21-12-15-5-9-17(10-6-15)24(26)27/h3-10,12-13,18H,11H2,1-2H3,(H,22,23,25)/b21-12-/t18-/m1/s1 |
| InChIKey | DTIKKWQSTMNAHI-UZQMFHLOSA-N |
| XLogP | 3.88 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|