C27H35N3O2S — CID 136829509
(2Z,5S)-2-[(Z)-(4-heptoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 136829509) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is (2Z,5S)-2-[(Z)-(4-heptoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-2-[(Z)-(4-heptoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136829509 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2Z,5S)-2-[(Z)-(4-heptoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCOc1ccc(/C=N\N=C2\NC(=O)[C@H](Cc3ccc(C(C)C)cc3)S2)cc1 |
| InChI | InChI=1S/C27H35N3O2S/c1-4-5-6-7-8-17-32-24-15-11-22(12-16-24)19-28-30-27-29-26(31)25(33-27)18-21-9-13-23(14-10-21)20(2)3/h9-16,19-20,25H,4-8,17-18H2,1-3H3,(H,29,30,31)/b28-19-/t25-/m0/s1 |
| InChIKey | CEIRCTSHIUOINC-GRWOLDDTSA-N |
| XLogP | 6.32 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|