C25H31N3O2S — CID 135779238
(2E)-2-[(4-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-butylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135779238) has the molecular formula C25H31N3O2S and a molecular weight of 437.61 g/mol. Its IUPAC name is (2E)-2-[(4-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-butylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(4-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-butylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135779238 |
| Molecular Formula | C25H31N3O2S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (2E)-2-[(4-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-butylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccc(C=N/N=C2\NC(=O)C(Cc3ccc(CCCC)cc3)S2)cc1 |
| InChI | InChI=1S/C25H31N3O2S/c1-3-5-7-19-8-10-20(11-9-19)17-23-24(29)27-25(31-23)28-26-18-21-12-14-22(15-13-21)30-16-6-4-2/h8-15,18,23H,3-7,16-17H2,1-2H3,(H,27,28,29) |
| InChIKey | USEAFHQMBMCKAE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|