C27H35N3O2S — CID 135562721
(2E)-5-[(4-ethylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135562721) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is (2E)-5-[(4-ethylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(4-ethylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135562721 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2E)-5-[(4-ethylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCOc1ccc(C=N/N=C2\NC(=O)C(Cc3ccc(CC)cc3)S2)cc1 |
| InChI | InChI=1S/C27H35N3O2S/c1-3-5-6-7-8-9-18-32-24-16-14-23(15-17-24)20-28-30-27-29-26(31)25(33-27)19-22-12-10-21(4-2)11-13-22/h10-17,20,25H,3-9,18-19H2,1-2H3,(H,29,30,31) |
| InChIKey | MOKHTFRSVWJOBP-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|