C29H39N3O2S — CID 135711096
(2E)-5-[(4-butylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135711096) has the molecular formula C29H39N3O2S and a molecular weight of 493.72 g/mol. Its IUPAC name is (2E)-5-[(4-butylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(4-butylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135711096 |
| Molecular Formula | C29H39N3O2S |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2E)-5-[(4-butylphenyl)methyl]-2-[(4-octoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCOc1ccc(C=N/N=C2\NC(=O)C(Cc3ccc(CCCC)cc3)S2)cc1 |
| InChI | InChI=1S/C29H39N3O2S/c1-3-5-7-8-9-10-20-34-26-18-16-25(17-19-26)22-30-32-29-31-28(33)27(35-29)21-24-14-12-23(13-15-24)11-6-4-2/h12-19,22,27H,3-11,20-21H2,1-2H3,(H,31,32,33) |
| InChIKey | WMXRMXPHVBHUAK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|