C23H27N3O2S — CID 135681471
(2Z)-2-[(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-ethylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135681471) has the molecular formula C23H27N3O2S and a molecular weight of 409.56 g/mol. Its IUPAC name is (2Z)-2-[(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-ethylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-ethylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135681471 |
| Molecular Formula | C23H27N3O2S |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2Z)-2-[(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(4-ethylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccccc1C=N/N=C1/NC(=O)C(Cc2ccc(CC)cc2)S1 |
| InChI | InChI=1S/C23H27N3O2S/c1-3-5-14-28-20-9-7-6-8-19(20)16-24-26-23-25-22(27)21(29-23)15-18-12-10-17(4-2)11-13-18/h6-13,16,21H,3-5,14-15H2,1-2H3,(H,25,26,27) |
| InChIKey | IJTAVIBLHHVUNC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|