C21H22ClN3O2S — CID 135712101
(2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135712101) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712101 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(3-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccccc1/C=N/N=C1\NC(=O)C(Cc2cccc(Cl)c2)S1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-2-3-11-27-18-10-5-4-8-16(18)14-23-25-21-24-20(26)19(28-21)13-15-7-6-9-17(22)12-15/h4-10,12,14,19H,2-3,11,13H2,1H3,(H,24,25,26)/b23-14+ |
| InChIKey | PCQALNLKPRJJCC-OEAKJJBVSA-N |
| XLogP | 4.68 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|