C21H21Cl2N3O2S — CID 135711984
(2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135711984) has the molecular formula C21H21Cl2N3O2S and a molecular weight of 450.39 g/mol. Its IUPAC name is (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135711984 |
| Molecular Formula | C21H21Cl2N3O2S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | (2E)-2-[(E)-(2-butoxyphenyl)methylidenehydrazinylidene]-5-[(2,5-dichlorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CCCCOc1ccccc1/C=N/N=C1\NC(=O)C(Cc2cc(Cl)ccc2Cl)S1 |
| InChI | InChI=1S/C21H21Cl2N3O2S/c1-2-3-10-28-18-7-5-4-6-14(18)13-24-26-21-25-20(27)19(29-21)12-15-11-16(22)8-9-17(15)23/h4-9,11,13,19H,2-3,10,12H2,1H3,(H,25,26,27)/b24-13+ |
| InChIKey | BZPZHHCPQKNOFQ-ZMOGYAJESA-N |
| XLogP | 5.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|