C18H15Cl2N3O2S — CID 135852036
(2E,5S)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135852036) has the molecular formula C18H15Cl2N3O2S and a molecular weight of 408.31 g/mol. Its IUPAC name is (2E,5S)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135852036 |
| Molecular Formula | C18H15Cl2N3O2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | (2E,5S)-5-[(2,5-dichlorophenyl)methyl]-2-[(Z)-(2-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1/C=N\N=C1/NC(=O)[C@H](Cc2cc(Cl)ccc2Cl)S1 |
| InChI | InChI=1S/C18H15Cl2N3O2S/c1-25-15-5-3-2-4-11(15)10-21-23-18-22-17(24)16(26-18)9-12-8-13(19)6-7-14(12)20/h2-8,10,16H,9H2,1H3,(H,22,23,24)/b21-10-/t16-/m0/s1 |
| InChIKey | XQFQTFARWRCVCJ-QZPXRHMKSA-N |
| XLogP | 4.17 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|