C27H23N5OS — CID 135447495
2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-methylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135447495) has the molecular formula C27H23N5OS and a molecular weight of 465.58 g/mol. Its IUPAC name is 2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-methylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-methylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135447495 |
| Molecular Formula | C27H23N5OS |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-5-[(4-methylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(CC2SC(=NN=Cc3cn(-c4ccccc4)nc3-c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C27H23N5OS/c1-19-12-14-20(15-13-19)16-24-26(33)29-27(34-24)30-28-17-22-18-32(23-10-6-3-7-11-23)31-25(22)21-8-4-2-5-9-21/h2-15,17-18,24H,16H2,1H3,(H,29,30,33) |
| InChIKey | HSVSBVFPZGRGAO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|