C26H20ClN5OS — CID 135460874
5-[(2-chlorophenyl)methyl]-2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135460874) has the molecular formula C26H20ClN5OS and a molecular weight of 486.00 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-chlorophenyl)methyl]-2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135460874 |
| Molecular Formula | C26H20ClN5OS |
| Molecular Weight | 486.00 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-2-[(1,3-diphenylpyrazol-4-yl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=NN=Cc2cn(-c3ccccc3)nc2-c2ccccc2)SC1Cc1ccccc1Cl |
| InChI | InChI=1S/C26H20ClN5OS/c27-22-14-8-7-11-19(22)15-23-25(33)29-26(34-23)30-28-16-20-17-32(21-12-5-2-6-13-21)31-24(20)18-9-3-1-4-10-18/h1-14,16-17,23H,15H2,(H,29,30,33) |
| InChIKey | GUSILQSUIPIVOY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.00 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|