C27H22ClN5O2S — CID 135712031
(2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135712031) has the molecular formula C27H22ClN5O2S and a molecular weight of 516.03 g/mol. Its IUPAC name is (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712031 |
| Molecular Formula | C27H22ClN5O2S |
| Molecular Weight | 516.03 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | (2E)-5-[(4-chlorophenyl)methyl]-2-[(E)-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=N/N=C2\NC(=O)C(Cc3ccc(Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C27H22ClN5O2S/c1-35-23-13-9-19(10-14-23)25-20(17-33(32-25)22-5-3-2-4-6-22)16-29-31-27-30-26(34)24(36-27)15-18-7-11-21(28)12-8-18/h2-14,16-17,24H,15H2,1H3,(H,30,31,34)/b29-16+ |
| InChIKey | YAZOHMHMWCQWRP-MUFRIFMGSA-N |
| XLogP | 5.37 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|