C16H13F2N3OS3 — CID 135582050
(2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one (PubChem CID 135582050) has the molecular formula C16H13F2N3OS3 and a molecular weight of 397.50 g/mol. Its IUPAC name is (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135582050 |
| Molecular Formula | C16H13F2N3OS3 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | (2E)-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=Cc2cccs2)SC1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H13F2N3OS3/c17-15(18)24-11-5-3-10(4-6-11)8-13-14(22)20-16(25-13)21-19-9-12-2-1-7-23-12/h1-7,9,13,15H,8H2,(H,20,21,22) |
| InChIKey | MDUJEVDLFHTHII-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|