C18H14ClF2N3OS2 — CID 135643806
(2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 135643806) has the molecular formula C18H14ClF2N3OS2 and a molecular weight of 425.91 g/mol. Its IUPAC name is (2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135643806 |
| Molecular Formula | C18H14ClF2N3OS2 |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | (2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2ccc(Cl)cc2)SC1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C18H14ClF2N3OS2/c19-13-5-1-12(2-6-13)10-22-24-18-23-16(25)15(27-18)9-11-3-7-14(8-4-11)26-17(20)21/h1-8,10,15,17H,9H2,(H,23,24,25)/b22-10+ |
| InChIKey | FPPYOTMLMPYRQM-LSHDLFTRSA-N |
| XLogP | 4.82 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|