C21H22ClN3OS — CID 135712021
(2E)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135712021) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is (2E)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135712021 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (2E)-2-[(E)-(4-tert-butylphenyl)methylidenehydrazinylidene]-5-[(4-chlorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1ccc(/C=N/N=C2\NC(=O)C(Cc3ccc(Cl)cc3)S2)cc1 |
| InChI | InChI=1S/C21H22ClN3OS/c1-21(2,3)16-8-4-15(5-9-16)13-23-25-20-24-19(26)18(27-20)12-14-6-10-17(22)11-7-14/h4-11,13,18H,12H2,1-3H3,(H,24,25,26)/b23-13+ |
| InChIKey | MBZOJGFKQHNYPZ-YDZHTSKRSA-N |
| XLogP | 4.80 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|