C20H20FN3O2S — CID 135800830
(2Z)-5-[(4-fluorophenyl)methyl]-2-[(2-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135800830) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is (2Z)-5-[(4-fluorophenyl)methyl]-2-[(2-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[(4-fluorophenyl)methyl]-2-[(2-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135800830 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (2Z)-5-[(4-fluorophenyl)methyl]-2-[(2-propan-2-yloxyphenyl)methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC(C)Oc1ccccc1C=N/N=C1/NC(=O)C(Cc2ccc(F)cc2)S1 |
| InChI | InChI=1S/C20H20FN3O2S/c1-13(2)26-17-6-4-3-5-15(17)12-22-24-20-23-19(25)18(27-20)11-14-7-9-16(21)10-8-14/h3-10,12-13,18H,11H2,1-2H3,(H,23,24,25) |
| InChIKey | XJSNDYSSXHTIMG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|