C22H16BrF2N3O2S2 — CID 135576455
(2Z)-2-[(E)-[5-(4-bromophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one (PubChem CID 135576455) has the molecular formula C22H16BrF2N3O2S2 and a molecular weight of 536.42 g/mol. Its IUPAC name is (2Z)-2-[(E)-[5-(4-bromophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-[5-(4-bromophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135576455 |
| Molecular Formula | C22H16BrF2N3O2S2 |
| Molecular Weight | 536.42 g/mol |
| Exact Mass | 534.98 |
| IUPAC Name | (2Z)-2-[(E)-[5-(4-bromophenyl)furan-2-yl]methylidenehydrazinylidene]-5-[[4-(difluoromethylsulfanyl)phenyl]methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/N=C/c2ccc(-c3ccc(Br)cc3)o2)SC1Cc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C22H16BrF2N3O2S2/c23-15-5-3-14(4-6-15)18-10-7-16(30-18)12-26-28-22-27-20(29)19(32-22)11-13-1-8-17(9-2-13)31-21(24)25/h1-10,12,19,21H,11H2,(H,27,28,29)/b26-12+ |
| InChIKey | KIBKJJYHMINQLK-RPPGKUMJSA-N |
| XLogP | 6.19 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|