C13H9N9O2 — CID 169345933
3-[2-(4-nitropyrazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345933) has the molecular formula C13H9N9O2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 3-[2-(4-nitropyrazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-(4-nitropyrazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345933 |
| Molecular Formula | C13H9N9O2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-[2-(4-nitropyrazol-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccccc1-n1cc([N+](=O)[O-])cn1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H9N9O2/c14-5-9(13-17-19-20-18-13)6-15-11-3-1-2-4-12(11)21-8-10(7-16-21)22(23)24/h1-4,6-8,15H,(H,17,18,19,20) |
| InChIKey | ZYFORNQHAUNECK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 151.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|