C14H16N6S — CID 169343306
3-(2-tert-butylsulfanylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343306) has the molecular formula C14H16N6S and a molecular weight of 300.39 g/mol. Its IUPAC name is 3-(2-tert-butylsulfanylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(2-tert-butylsulfanylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343306 |
| Molecular Formula | C14H16N6S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-(2-tert-butylsulfanylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC(C)(C)Sc1ccccc1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C14H16N6S/c1-14(2,3)21-12-7-5-4-6-11(12)16-9-10(8-15)13-17-19-20-18-13/h4-7,9,16H,1-3H3,(H,17,18,19,20) |
| InChIKey | WMFQVRSGHZVISO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|