C11H8N8 — CID 169347034
3-(1H-indazol-7-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169347034) has the molecular formula C11H8N8 and a molecular weight of 252.24 g/mol. Its IUPAC name is 3-(1H-indazol-7-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(1H-indazol-7-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169347034 |
| Molecular Formula | C11H8N8 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(1H-indazol-7-ylamino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cccc2cn[nH]c12)c1nn[nH]n1 |
| InChI | InChI=1S/C11H8N8/c12-4-8(11-16-18-19-17-11)5-13-9-3-1-2-7-6-14-15-10(7)9/h1-3,5-6,13H,(H,14,15)(H,16,17,18,19) |
| InChIKey | KHCGLLGLHXRAKQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 118.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|