C14H11N7 — CID 169342279
3-[(2-methylquinolin-8-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342279) has the molecular formula C14H11N7 and a molecular weight of 277.29 g/mol. Its IUPAC name is 3-[(2-methylquinolin-8-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(2-methylquinolin-8-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342279 |
| Molecular Formula | C14H11N7 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-[(2-methylquinolin-8-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc2cccc(NC=C(C#N)c3nn[nH]n3)c2n1 |
| InChI | InChI=1S/C14H11N7/c1-9-5-6-10-3-2-4-12(13(10)17-9)16-8-11(7-15)14-18-20-21-19-14/h2-6,8,16H,1H3,(H,18,19,20,21) |
| InChIKey | QBNJOARYJBKKDK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|