C14H10N6O3S — CID 169347031
8-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1-sulfonic acid (PubChem CID 169347031) has the molecular formula C14H10N6O3S and a molecular weight of 342.34 g/mol. Its IUPAC name is 8-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1-sulfonic acid.
| Compound Name | 8-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 169347031 |
| Molecular Formula | C14H10N6O3S |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 8-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]naphthalene-1-sulfonic acid |
| SMILES | N#CC(=CNc1cccc2cccc(S(=O)(=O)O)c12)c1nn[nH]n1 |
| InChI | InChI=1S/C14H10N6O3S/c15-7-10(14-17-19-20-18-14)8-16-11-5-1-3-9-4-2-6-12(13(9)11)24(21,22)23/h1-6,8,16H,(H,21,22,23)(H,17,18,19,20) |
| InChIKey | RGOWYRULRAWMEW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 144.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|