About 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile
3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 67885444) has the molecular formula C11H11N7
and a molecular weight of 241.26 g/mol. Its IUPAC name is 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| PubChem CID | 67885444 |
| Molecular Formula | C11H11N7 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1cc(C)nc(NC=C(C#N)c2nn[nH]n2)c1 |
| InChI | InChI=1S/C11H11N7/c1-7-3-8(2)14-10(4-7)13-6-9(5-12)11-15-17-18-16-11/h3-4,6H,1-2H3,(H,13,14)(H,15,16,17,18) |
| InChIKey | CPSUHDORLLHUDK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The IUPAC name of 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (CID 67885444) is 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
What is the SMILES notation for 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The canonical SMILES for 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile is Cc1cc(C)nc(NC=C(C#N)c2nn[nH]n2)c1.
What is the InChIKey of 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
The InChIKey is CPSUHDORLLHUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N7/c1-7-3-8(2)14-10(4-7)13-6-9(5-12)11-15-17-18-16-11/h3-4,6H,1-2H3,(H,13,14)(H,15,16,17,18).
What are the key properties of 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile?
3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile has a molecular weight of 241.26 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,6-dimethyl-2-pyridinyl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile is sourced from PubChem (CID 67885444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).