C16H19BrN6 — CID 169342543
3-[4-bromo-2,6-di(propan-2-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342543) has the molecular formula C16H19BrN6 and a molecular weight of 375.27 g/mol. Its IUPAC name is 3-[4-bromo-2,6-di(propan-2-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[4-bromo-2,6-di(propan-2-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342543 |
| Molecular Formula | C16H19BrN6 |
| Molecular Weight | 375.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-[4-bromo-2,6-di(propan-2-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC(C)c1cc(Br)cc(C(C)C)c1NC=C(C#N)c1nn[nH]n1 |
| InChI | InChI=1S/C16H19BrN6/c1-9(2)13-5-12(17)6-14(10(3)4)15(13)19-8-11(7-18)16-20-22-23-21-16/h5-6,8-10,19H,1-4H3,(H,20,21,22,23) |
| InChIKey | RRLCSTZYCRTXPQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|